methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid

C10H11BOS — CID 58343955

IUPACmethyl-(5-methyl-1-benzothiophen-3-yl)borinic acid
SMILESCB(O)c1csc2ccc(C)cc12
InChIInChI=1S/C10H11BOS/c1-7-3-4-10-8(5-7)9(6-13-10)11(2)12/h3-6,12H,1-2H3
InChIKeyIQAJRFMGHQHGOR-UHFFFAOYSA-N
MW190.08 g/mol
LogP2.03
Rot. Bonds1

About methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid

methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid (PubChem CID 58343955) has the molecular formula C10H11BOS and a molecular weight of 190.08 g/mol. Its IUPAC name is methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid.

Molecular Properties

Compound Namemethyl-(5-methyl-1-benzothiophen-3-yl)borinic acid
PubChem CID58343955
Molecular FormulaC10H11BOS
Molecular Weight190.08 g/mol
Exact Mass190.06
IUPAC Namemethyl-(5-methyl-1-benzothiophen-3-yl)borinic acid
SMILESCB(O)c1csc2ccc(C)cc12
InChIInChI=1S/C10H11BOS/c1-7-3-4-10-8(5-7)9(6-13-10)11(2)12/h3-6,12H,1-2H3
InChIKeyIQAJRFMGHQHGOR-UHFFFAOYSA-N
XLogP2.03
TPSA20.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.08
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid?
The IUPAC name of methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid (CID 58343955) is methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid.
What is the SMILES notation for methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid?
The canonical SMILES for methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid is CB(O)c1csc2ccc(C)cc12.
What is the InChIKey of methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid?
The InChIKey is IQAJRFMGHQHGOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BOS/c1-7-3-4-10-8(5-7)9(6-13-10)11(2)12/h3-6,12H,1-2H3.
What are the key properties of methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid?
methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid has a molecular weight of 190.08 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-(5-methyl-1-benzothiophen-3-yl)borinic acid is sourced from PubChem (CID 58343955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).