About 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene
1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene (PubChem CID 58344104) has the molecular formula C22H26F2O2S
and a molecular weight of 392.51 g/mol. Its IUPAC name is 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene.
Molecular Properties
| Compound Name | 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene |
| PubChem CID | 58344104 |
| Molecular Formula | C22H26F2O2S |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene |
| SMILES | CC(C)(C)C1CC[C@@H](CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)C1 |
| InChI | InChI=1S/C22H26F2O2S/c1-22(2,3)17-7-4-15(12-17)14-27(25,26)19-9-5-16(6-10-19)20-11-8-18(23)13-21(20)24/h5-6,8-11,13,15,17H,4,7,12,14H2,1-3H3/t15-,17?/m1/s1 |
| InChIKey | GWNGAEPQYVVQRL-LDCVWXEPSA-N |
| XLogP | 5.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene?
The IUPAC name of 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene (CID 58344104) is 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene.
What is the SMILES notation for 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene?
The canonical SMILES for 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene is CC(C)(C)C1CC[C@@H](CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)C1.
What is the InChIKey of 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene?
The InChIKey is GWNGAEPQYVVQRL-LDCVWXEPSA-N. The full InChI is InChI=1S/C22H26F2O2S/c1-22(2,3)17-7-4-15(12-17)14-27(25,26)19-9-5-16(6-10-19)20-11-8-18(23)13-21(20)24/h5-6,8-11,13,15,17H,4,7,12,14H2,1-3H3/t15-,17?/m1/s1.
What are the key properties of 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene?
1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene has a molecular weight of 392.51 g/mol, XLogP of 5.87, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[(1R)-3-tert-butylcyclopentyl]methylsulfonyl]phenyl]-2,4-difluorobenzene is sourced from PubChem (CID 58344104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).