About 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol
4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol (PubChem CID 58344231) has the molecular formula C19H20F2O3S
and a molecular weight of 366.43 g/mol. Its IUPAC name is 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol |
| PubChem CID | 58344231 |
| Molecular Formula | C19H20F2O3S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol |
| SMILES | O=S(=O)(CC1CCC(O)CC1)c1ccc(-c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C19H20F2O3S/c20-15-5-10-19(21)18(11-15)14-3-8-17(9-4-14)25(23,24)12-13-1-6-16(22)7-2-13/h3-5,8-11,13,16,22H,1-2,6-7,12H2 |
| InChIKey | XQESQNGNRNMXBQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol?
The IUPAC name of 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol (CID 58344231) is 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol.
What is the SMILES notation for 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol?
The canonical SMILES for 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol is O=S(=O)(CC1CCC(O)CC1)c1ccc(-c2cc(F)ccc2F)cc1.
What is the InChIKey of 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol?
The InChIKey is XQESQNGNRNMXBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F2O3S/c20-15-5-10-19(21)18(11-15)14-3-8-17(9-4-14)25(23,24)12-13-1-6-16(22)7-2-13/h3-5,8-11,13,16,22H,1-2,6-7,12H2.
What are the key properties of 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol?
4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol has a molecular weight of 366.43 g/mol, XLogP of 3.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(2,5-difluorophenyl)phenyl]sulfonylmethyl]cyclohexan-1-ol is sourced from PubChem (CID 58344231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).