About (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide
(1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide (PubChem CID 58344597) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide.
Molecular Properties
| Compound Name | (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide |
| PubChem CID | 58344597 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide |
| SMILES | N/C(=N/O)c1cccc2c1CC[C@@H]2O |
| InChI | InChI=1S/C10H12N2O2/c11-10(12-14)8-3-1-2-7-6(8)4-5-9(7)13/h1-3,9,13-14H,4-5H2,(H2,11,12)/t9-/m0/s1 |
| InChIKey | DZCSWIQGBIAWSF-VIFPVBQESA-N |
| XLogP | 0.76 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide?
The IUPAC name of (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide (CID 58344597) is (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide.
What is the SMILES notation for (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide?
The canonical SMILES for (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide is N/C(=N/O)c1cccc2c1CC[C@@H]2O.
What is the InChIKey of (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide?
The InChIKey is DZCSWIQGBIAWSF-VIFPVBQESA-N. The full InChI is InChI=1S/C10H12N2O2/c11-10(12-14)8-3-1-2-7-6(8)4-5-9(7)13/h1-3,9,13-14H,4-5H2,(H2,11,12)/t9-/m0/s1.
What are the key properties of (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide?
(1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide has a molecular weight of 192.22 g/mol, XLogP of 0.76, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N',1-dihydroxy-2,3-dihydro-1H-indene-4-carboximidamide is sourced from PubChem (CID 58344597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).