C31H24FN7O — CID 58344965
N-[[4-[5-(2-aminophenyl)-2-(2-amino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-3-fluorobenzamide (PubChem CID 58344965) has the molecular formula C31H24FN7O and a molecular weight of 529.58 g/mol. Its IUPAC name is N-[[4-[5-(2-aminophenyl)-2-(2-amino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-3-fluorobenzamide.
| Compound Name | N-[[4-[5-(2-aminophenyl)-2-(2-amino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 58344965 |
| Molecular Formula | C31H24FN7O |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | N-[[4-[5-(2-aminophenyl)-2-(2-amino-3-pyridinyl)imidazo[4,5-b]pyridin-3-yl]phenyl]methyl]-3-fluorobenzamide |
| SMILES | Nc1ccccc1-c1ccc2nc(-c3cccnc3N)n(-c3ccc(CNC(=O)c4cccc(F)c4)cc3)c2n1 |
| InChI | InChI=1S/C31H24FN7O/c32-21-6-3-5-20(17-21)31(40)36-18-19-10-12-22(13-11-19)39-29(24-8-4-16-35-28(24)34)38-27-15-14-26(37-30(27)39)23-7-1-2-9-25(23)33/h1-17H,18,33H2,(H2,34,35)(H,36,40) |
| InChIKey | SMQWHIUANKFIKD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|