About 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine
2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine (PubChem CID 58344981) has the molecular formula C21H22N6
and a molecular weight of 358.45 g/mol. Its IUPAC name is 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine |
| PubChem CID | 58344981 |
| Molecular Formula | C21H22N6 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3cccnc3N)nc3cc(N)cnc32)cc1 |
| InChI | InChI=1S/C21H22N6/c1-21(2,3)13-6-8-15(9-7-13)27-19(16-5-4-10-24-18(16)23)26-17-11-14(22)12-25-20(17)27/h4-12H,22H2,1-3H3,(H2,23,24) |
| InChIKey | HIHLIQPMDLKDPU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine?
The IUPAC name of 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine (CID 58344981) is 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine.
What is the SMILES notation for 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine?
The canonical SMILES for 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine is CC(C)(C)c1ccc(-n2c(-c3cccnc3N)nc3cc(N)cnc32)cc1.
What is the InChIKey of 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine?
The InChIKey is HIHLIQPMDLKDPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N6/c1-21(2,3)13-6-8-15(9-7-13)27-19(16-5-4-10-24-18(16)23)26-17-11-14(22)12-25-20(17)27/h4-12H,22H2,1-3H3,(H2,23,24).
What are the key properties of 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine?
2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine has a molecular weight of 358.45 g/mol, XLogP of 3.94, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-3-pyridinyl)-3-(4-tert-butylphenyl)imidazo[4,5-b]pyridin-6-amine is sourced from PubChem (CID 58344981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).