About tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate
tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate (PubChem CID 58345823) has the molecular formula C30H45NO3Si
and a molecular weight of 495.78 g/mol. Its IUPAC name is tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate |
| PubChem CID | 58345823 |
| Molecular Formula | C30H45NO3Si |
| Molecular Weight | 495.78 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate |
| SMILES | CC(C)C[C@@H](/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H45NO3Si/c1-24(2)23-25(31-28(32)34-29(3,4)5)17-15-16-22-33-35(30(6,7)8,26-18-11-9-12-19-26)27-20-13-10-14-21-27/h9-15,17-21,24-25H,16,22-23H2,1-8H3,(H,31,32)/b17-15+/t25-/m1/s1 |
| InChIKey | ILCKOHXZGRBTOX-YEXLONIWSA-N |
| XLogP | 6.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.78 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate?
The IUPAC name of tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate (CID 58345823) is tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate.
What is the SMILES notation for tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate?
The canonical SMILES for tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate is CC(C)C[C@@H](/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate?
The InChIKey is ILCKOHXZGRBTOX-YEXLONIWSA-N. The full InChI is InChI=1S/C30H45NO3Si/c1-24(2)23-25(31-28(32)34-29(3,4)5)17-15-16-22-33-35(30(6,7)8,26-18-11-9-12-19-26)27-20-13-10-14-21-27/h9-15,17-21,24-25H,16,22-23H2,1-8H3,(H,31,32)/b17-15+/t25-/m1/s1.
What are the key properties of tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate?
tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate has a molecular weight of 495.78 g/mol, XLogP of 6.45, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(E,4S)-8-[tert-butyl(diphenyl)silyl]oxy-2-methyloct-5-en-4-yl]carbamate is sourced from PubChem (CID 58345823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).