C23H20N2O5 — CID 58346248
6-(3,4-dimethoxyphenyl)-4-phenacylpyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 58346248) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-phenacylpyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-phenacylpyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 58346248 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-phenacylpyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | COc1ccc(-c2ccc3c(n2)N(CC(=O)c2ccccc2)C(=O)CO3)cc1OC |
| InChI | InChI=1S/C23H20N2O5/c1-28-19-10-8-16(12-21(19)29-2)17-9-11-20-23(24-17)25(22(27)14-30-20)13-18(26)15-6-4-3-5-7-15/h3-12H,13-14H2,1-2H3 |
| InChIKey | GICZTYUGJRRTPG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |