C20H41IOSi — CID 58346378
tert-butyl-[(Z,2R,3S,4R,5S)-1-iodo-2,4,5,6-tetramethyldec-7-en-3-yl]oxy-dimethylsilane (PubChem CID 58346378) has the molecular formula C20H41IOSi and a molecular weight of 452.54 g/mol. Its IUPAC name is tert-butyl-[(Z,2R,3S,4R,5S)-1-iodo-2,4,5,6-tetramethyldec-7-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(Z,2R,3S,4R,5S)-1-iodo-2,4,5,6-tetramethyldec-7-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 58346378 |
| Molecular Formula | C20H41IOSi |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | tert-butyl-[(Z,2R,3S,4R,5S)-1-iodo-2,4,5,6-tetramethyldec-7-en-3-yl]oxy-dimethylsilane |
| SMILES | CC/C=C\C(C)[C@H](C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CI |
| InChI | InChI=1S/C20H41IOSi/c1-11-12-13-15(2)17(4)18(5)19(16(3)14-21)22-23(9,10)20(6,7)8/h12-13,15-19H,11,14H2,1-10H3/b13-12-/t15?,16-,17-,18+,19+/m0/s1 |
| InChIKey | HDLIOMBBJVKVOS-JJBFNQDDSA-N |
| XLogP | 7.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|