C37H76O4Si2 — CID 58346379
tert-butyl-[(3R,4S,5Z,8S,9R,10R,11S,13Z)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6,8,10,11,12-heptamethylhexadeca-5,13-dienoxy]-dimethylsilane (PubChem CID 58346379) has the molecular formula C37H76O4Si2 and a molecular weight of 641.18 g/mol. Its IUPAC name is tert-butyl-[(3R,4S,5Z,8S,9R,10R,11S,13Z)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6,8,10,11,12-heptamethylhexadeca-5,13-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(3R,4S,5Z,8S,9R,10R,11S,13Z)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6,8,10,11,12-heptamethylhexadeca-5,13-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 58346379 |
| Molecular Formula | C37H76O4Si2 |
| Molecular Weight | 641.18 g/mol |
| Exact Mass | 640.53 |
| IUPAC Name | tert-butyl-[(3R,4S,5Z,8S,9R,10R,11S,13Z)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6,8,10,11,12-heptamethylhexadeca-5,13-dienoxy]-dimethylsilane |
| SMILES | CC/C=C\C(C)[C@H](C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](OCOC)C(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H76O4Si2/c1-20-21-22-28(3)32(7)33(8)35(41-43(18,19)37(12,13)14)30(5)24-27(2)23-29(4)34(39-26-38-15)31(6)25-40-42(16,17)36(9,10)11/h21-23,28-35H,20,24-26H2,1-19H3/b22-21-,27-23-/t28?,29-,30-,31?,32-,33+,34+,35+/m0/s1 |
| InChIKey | DXUBJQHUYUAJOS-NFUWJXTDSA-N |
| XLogP | 11.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.18 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|