C31H62O4Si — CID 58346380
(3R,4S,5Z,8S,9R,10R,11S,13Z)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6,8,10,11,12-heptamethylhexadeca-5,13-dien-1-ol (PubChem CID 58346380) has the molecular formula C31H62O4Si and a molecular weight of 526.92 g/mol. Its IUPAC name is (3R,4S,5Z,8S,9R,10R,11S,13Z)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6,8,10,11,12-heptamethylhexadeca-5,13-dien-1-ol.
| Compound Name | (3R,4S,5Z,8S,9R,10R,11S,13Z)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6,8,10,11,12-heptamethylhexadeca-5,13-dien-1-ol |
|---|---|
| PubChem CID | 58346380 |
| Molecular Formula | C31H62O4Si |
| Molecular Weight | 526.92 g/mol |
| Exact Mass | 526.44 |
| IUPAC Name | (3R,4S,5Z,8S,9R,10R,11S,13Z)-9-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-2,4,6,8,10,11,12-heptamethylhexadeca-5,13-dien-1-ol |
| SMILES | CC/C=C\C(C)[C@H](C)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](OCOC)C(C)CO |
| InChI | InChI=1S/C31H62O4Si/c1-15-16-17-23(3)27(7)28(8)30(35-36(13,14)31(9,10)11)25(5)19-22(2)18-24(4)29(26(6)20-32)34-21-33-12/h16-18,23-30,32H,15,19-21H2,1-14H3/b17-16-,22-18-/t23?,24-,25-,26?,27-,28+,29+,30+/m0/s1 |
| InChIKey | FGFHQTFKLYYCJG-YRGCJREVSA-N |
| XLogP | 8.48 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.92 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|