C28H24FN7O3S2 — CID 58346423
2-[11-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-5-yl]ethyl methanesulfonate (PubChem CID 58346423) has the molecular formula C28H24FN7O3S2 and a molecular weight of 589.68 g/mol. Its IUPAC name is 2-[11-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-5-yl]ethyl methanesulfonate.
| Compound Name | 2-[11-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-5-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 58346423 |
| Molecular Formula | C28H24FN7O3S2 |
| Molecular Weight | 589.68 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | 2-[11-[[1-[(3-fluorophenyl)methyl]indazol-5-yl]amino]-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaen-5-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCn1ncc2c1CCc1c-2sc2ncnc(Nc3ccc4c(cnn4Cc4cccc(F)c4)c3)c12 |
| InChI | InChI=1S/C28H24FN7O3S2/c1-41(37,38)39-10-9-35-24-8-6-21-25-27(30-16-31-28(25)40-26(21)22(24)14-33-35)34-20-5-7-23-18(12-20)13-32-36(23)15-17-3-2-4-19(29)11-17/h2-5,7,11-14,16H,6,8-10,15H2,1H3,(H,30,31,34) |
| InChIKey | CICIDMRQHUFQTO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|