C25H27N7O3S — CID 58346691
11-[2-(4-nitrophenyl)ethoxy]-5-(2-piperazin-1-ylethyl)-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaene (PubChem CID 58346691) has the molecular formula C25H27N7O3S and a molecular weight of 505.60 g/mol. Its IUPAC name is 11-[2-(4-nitrophenyl)ethoxy]-5-(2-piperazin-1-ylethyl)-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaene.
| Compound Name | 11-[2-(4-nitrophenyl)ethoxy]-5-(2-piperazin-1-ylethyl)-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaene |
|---|---|
| PubChem CID | 58346691 |
| Molecular Formula | C25H27N7O3S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 11-[2-(4-nitrophenyl)ethoxy]-5-(2-piperazin-1-ylethyl)-16-thia-4,5,12,14-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,10,12,14-hexaene |
| SMILES | O=[N+]([O-])c1ccc(CCOc2ncnc3sc4c(c23)CCc2c-4cnn2CCN2CCNCC2)cc1 |
| InChI | InChI=1S/C25H27N7O3S/c33-32(34)18-3-1-17(2-4-18)7-14-35-24-22-19-5-6-21-20(23(19)36-25(22)28-16-27-24)15-29-31(21)13-12-30-10-8-26-9-11-30/h1-4,15-16,26H,5-14H2 |
| InChIKey | YTNGVUVWZSOWBF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|