C25H21F2N3O3 — CID 58347212
2-[6-(4-amino-3-methanimidoylphenyl)-5-methyl-2-pyridinyl]-1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]ethanone (PubChem CID 58347212) has the molecular formula C25H21F2N3O3 and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-[6-(4-amino-3-methanimidoylphenyl)-5-methyl-2-pyridinyl]-1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]ethanone.
| Compound Name | 2-[6-(4-amino-3-methanimidoylphenyl)-5-methyl-2-pyridinyl]-1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]ethanone |
|---|---|
| PubChem CID | 58347212 |
| Molecular Formula | C25H21F2N3O3 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-[6-(4-amino-3-methanimidoylphenyl)-5-methyl-2-pyridinyl]-1-[1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropyl]ethanone |
| SMILES | [H]/N=C/c1cc(-c2nc(CC(=O)C3(c4ccc5c(c4)OC(F)(F)O5)CC3)ccc2C)ccc1N |
| InChI | InChI=1S/C25H21F2N3O3/c1-14-2-5-18(30-23(14)15-3-6-19(29)16(10-15)13-28)12-22(31)24(8-9-24)17-4-7-20-21(11-17)33-25(26,27)32-20/h2-7,10-11,13,28H,8-9,12,29H2,1H3/b28-13+ |
| InChIKey | DVEPRSPKNXEBTK-XODNFHPESA-N |
| XLogP | 4.80 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|