About 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol
2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 58347290) has the molecular formula C9H8BrF3O
and a molecular weight of 269.06 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 58347290 |
| Molecular Formula | C9H8BrF3O |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H8BrF3O/c1-8(14,9(11,12)13)6-2-4-7(10)5-3-6/h2-5,14H,1H3 |
| InChIKey | ZWLWJQBJGOXGMA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol (CID 58347290) is 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol is CC(O)(c1ccc(Br)cc1)C(F)(F)F.
What is the InChIKey of 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol?
The InChIKey is ZWLWJQBJGOXGMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrF3O/c1-8(14,9(11,12)13)6-2-4-7(10)5-3-6/h2-5,14H,1H3.
What are the key properties of 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol?
2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol has a molecular weight of 269.06 g/mol, XLogP of 3.22, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 58347290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).