C15H21ClN4O3 — CID 58347920
tert-butyl 4-[2-(3-chloropyrazin-2-yl)acetyl]piperazine-1-carboxylate (PubChem CID 58347920) has the molecular formula C15H21ClN4O3 and a molecular weight of 340.81 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-chloropyrazin-2-yl)acetyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-chloropyrazin-2-yl)acetyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58347920 |
| Molecular Formula | C15H21ClN4O3 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | tert-butyl 4-[2-(3-chloropyrazin-2-yl)acetyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)Cc2nccnc2Cl)CC1 |
| InChI | InChI=1S/C15H21ClN4O3/c1-15(2,3)23-14(22)20-8-6-19(7-9-20)12(21)10-11-13(16)18-5-4-17-11/h4-5H,6-10H2,1-3H3 |
| InChIKey | LWMVQDWJPMUWHF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |