C46H56N8O8 — CID 58348792
methyl 2,5-bis[2-[(2S,4S)-1-[(2S)-2-(methoxycarbonylamino)-3-methylbutanoyl]-4-methylpyrrolidin-2-yl]-3H-benzimidazol-5-yl]benzoate (PubChem CID 58348792) has the molecular formula C46H56N8O8 and a molecular weight of 849.00 g/mol. Its IUPAC name is methyl 2,5-bis[2-[(2S,4S)-1-[(2S)-2-(methoxycarbonylamino)-3-methylbutanoyl]-4-methylpyrrolidin-2-yl]-3H-benzimidazol-5-yl]benzoate.
| Compound Name | methyl 2,5-bis[2-[(2S,4S)-1-[(2S)-2-(methoxycarbonylamino)-3-methylbutanoyl]-4-methylpyrrolidin-2-yl]-3H-benzimidazol-5-yl]benzoate |
|---|---|
| PubChem CID | 58348792 |
| Molecular Formula | C46H56N8O8 |
| Molecular Weight | 849.00 g/mol |
| Exact Mass | 848.42 |
| IUPAC Name | methyl 2,5-bis[2-[(2S,4S)-1-[(2S)-2-(methoxycarbonylamino)-3-methylbutanoyl]-4-methylpyrrolidin-2-yl]-3H-benzimidazol-5-yl]benzoate |
| SMILES | COC(=O)N[C@H](C(=O)N1C[C@@H](C)C[C@H]1c1nc2ccc(-c3ccc(-c4ccc5nc([C@@H]6C[C@H](C)CN6C(=O)[C@@H](NC(=O)OC)C(C)C)[nH]c5c4)c(C(=O)OC)c3)cc2[nH]1)C(C)C |
| InChI | InChI=1S/C46H56N8O8/c1-23(2)38(51-45(58)61-8)42(55)53-21-25(5)16-36(53)40-47-32-14-11-28(19-34(32)49-40)27-10-13-30(31(18-27)44(57)60-7)29-12-15-33-35(20-29)50-41(48-33)37-17-26(6)22-54(37)43(56)39(24(3)4)52-46(59)62-9/h10-15,18-20,23-26,36-39H,16-17,21-22H2,1-9H3,(H,47,49)(H,48,50)(H,51,58)(H,52,59)/t25-,26-,36-,37-,38-,39-/m0/s1 |
| InChIKey | DTWQTNYTVRRZNI-PYWCQSODSA-N |
| XLogP | 7.14 |
| TPSA | 200.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.00 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|