C22H30N2O5 — CID 58348923
4-[[[3-[[[(R)-(3,4-dihydroxyphenyl)-hydroxymethyl]amino]methyl]cyclohexyl]methylamino]methyl]benzene-1,2-diol (PubChem CID 58348923) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is 4-[[[3-[[[(R)-(3,4-dihydroxyphenyl)-hydroxymethyl]amino]methyl]cyclohexyl]methylamino]methyl]benzene-1,2-diol.
| Compound Name | 4-[[[3-[[[(R)-(3,4-dihydroxyphenyl)-hydroxymethyl]amino]methyl]cyclohexyl]methylamino]methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 58348923 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 4-[[[3-[[[(R)-(3,4-dihydroxyphenyl)-hydroxymethyl]amino]methyl]cyclohexyl]methylamino]methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNCC2CCCC(CN[C@H](O)c3ccc(O)c(O)c3)C2)cc1O |
| InChI | InChI=1S/C22H30N2O5/c25-18-6-4-16(9-20(18)27)12-23-11-14-2-1-3-15(8-14)13-24-22(29)17-5-7-19(26)21(28)10-17/h4-7,9-10,14-15,22-29H,1-3,8,11-13H2/t14?,15?,22-/m1/s1 |
| InChIKey | HGVROKITFZSCRC-BYHBIXDJSA-N |
| XLogP | 2.69 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|