About (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane
(2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane (PubChem CID 58348948) has the molecular formula C14H26S
and a molecular weight of 226.43 g/mol. Its IUPAC name is (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane.
Molecular Properties
| Compound Name | (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane |
| PubChem CID | 58348948 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane |
| SMILES | C=C(CCCC[C@@H]1CCCS1)C(C)(C)C |
| InChI | InChI=1S/C14H26S/c1-12(14(2,3)4)8-5-6-9-13-10-7-11-15-13/h13H,1,5-11H2,2-4H3/t13-/m1/s1 |
| InChIKey | MYSBWNYICAKWFY-CYBMUJFWSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane?
The IUPAC name of (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane (CID 58348948) is (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane.
What is the SMILES notation for (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane?
The canonical SMILES for (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane is C=C(CCCC[C@@H]1CCCS1)C(C)(C)C.
What is the InChIKey of (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane?
The InChIKey is MYSBWNYICAKWFY-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H26S/c1-12(14(2,3)4)8-5-6-9-13-10-7-11-15-13/h13H,1,5-11H2,2-4H3/t13-/m1/s1.
What are the key properties of (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane?
(2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane has a molecular weight of 226.43 g/mol, XLogP of 5.04, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(6,6-dimethyl-5-methylideneheptyl)thiolane is sourced from PubChem (CID 58348948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).