C28H44N2O — CID 58348997
(4Z,7Z,10Z,13Z,16Z,19Z)-1-[(3S,5R)-3,5-dimethylpiperazin-1-yl]docosa-4,7,10,13,16,19-hexaen-1-one (PubChem CID 58348997) has the molecular formula C28H44N2O and a molecular weight of 424.67 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-1-[(3S,5R)-3,5-dimethylpiperazin-1-yl]docosa-4,7,10,13,16,19-hexaen-1-one.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-1-[(3S,5R)-3,5-dimethylpiperazin-1-yl]docosa-4,7,10,13,16,19-hexaen-1-one |
|---|---|
| PubChem CID | 58348997 |
| Molecular Formula | C28H44N2O |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.35 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-1-[(3S,5R)-3,5-dimethylpiperazin-1-yl]docosa-4,7,10,13,16,19-hexaen-1-one |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N1C[C@@H](C)N[C@@H](C)C1 |
| InChI | InChI=1S/C28H44N2O/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-28(31)30-24-26(2)29-27(3)25-30/h5-6,8-9,11-12,14-15,17-18,20-21,26-27,29H,4,7,10,13,16,19,22-25H2,1-3H3/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20-/t26-,27+ |
| InChIKey | RKSSPMUJMIDDMB-SSUHEGIVSA-N |
| XLogP | 6.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|