C29H41NO4 — CID 58349002
2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl (E)-4-oxopent-2-enoate (PubChem CID 58349002) has the molecular formula C29H41NO4 and a molecular weight of 467.65 g/mol. Its IUPAC name is 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl (E)-4-oxopent-2-enoate.
| Compound Name | 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl (E)-4-oxopent-2-enoate |
|---|---|
| PubChem CID | 58349002 |
| Molecular Formula | C29H41NO4 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethyl (E)-4-oxopent-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCOC(=O)/C=C/C(C)=O |
| InChI | InChI=1S/C29H41NO4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-28(32)30-25-26-34-29(33)24-23-27(2)31/h4-5,7-8,10-11,13-14,16-17,19-20,23-24H,3,6,9,12,15,18,21-22,25-26H2,1-2H3,(H,30,32)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-,24-23+ |
| InChIKey | ANYXHPSTJHCKNJ-CKDYJQHLSA-N |
| XLogP | 6.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|