C17H11N5O2 — CID 58349158
3-cyano-N-(6-pyridin-3-yloxypyrazin-2-yl)benzamide (PubChem CID 58349158) has the molecular formula C17H11N5O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is 3-cyano-N-(6-pyridin-3-yloxypyrazin-2-yl)benzamide.
| Compound Name | 3-cyano-N-(6-pyridin-3-yloxypyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 58349158 |
| Molecular Formula | C17H11N5O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-cyano-N-(6-pyridin-3-yloxypyrazin-2-yl)benzamide |
| SMILES | N#Cc1cccc(C(=O)Nc2cncc(Oc3cccnc3)n2)c1 |
| InChI | InChI=1S/C17H11N5O2/c18-8-12-3-1-4-13(7-12)17(23)22-15-10-20-11-16(21-15)24-14-5-2-6-19-9-14/h1-7,9-11H,(H,21,22,23) |
| InChIKey | DLQVIQMKTCLGMF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |