C16H11FN4O2 — CID 58349221
2-(3-fluoro-2-pyridinyl)-1-(4-pyrimidin-5-yloxy-2-pyridinyl)ethanone (PubChem CID 58349221) has the molecular formula C16H11FN4O2 and a molecular weight of 310.29 g/mol. Its IUPAC name is 2-(3-fluoro-2-pyridinyl)-1-(4-pyrimidin-5-yloxy-2-pyridinyl)ethanone.
| Compound Name | 2-(3-fluoro-2-pyridinyl)-1-(4-pyrimidin-5-yloxy-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 58349221 |
| Molecular Formula | C16H11FN4O2 |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-(3-fluoro-2-pyridinyl)-1-(4-pyrimidin-5-yloxy-2-pyridinyl)ethanone |
| SMILES | O=C(Cc1ncccc1F)c1cc(Oc2cncnc2)ccn1 |
| InChI | InChI=1S/C16H11FN4O2/c17-13-2-1-4-20-14(13)7-16(22)15-6-11(3-5-21-15)23-12-8-18-10-19-9-12/h1-6,8-10H,7H2 |
| InChIKey | LVYCBBFSFNKBAR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |