C18H15FN4O2 — CID 58349284
2-(6-ethyl-5-fluoro-2-pyridinyl)-1-(4-pyrimidin-5-yloxy-2-pyridinyl)ethanone (PubChem CID 58349284) has the molecular formula C18H15FN4O2 and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-(6-ethyl-5-fluoro-2-pyridinyl)-1-(4-pyrimidin-5-yloxy-2-pyridinyl)ethanone.
| Compound Name | 2-(6-ethyl-5-fluoro-2-pyridinyl)-1-(4-pyrimidin-5-yloxy-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 58349284 |
| Molecular Formula | C18H15FN4O2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-(6-ethyl-5-fluoro-2-pyridinyl)-1-(4-pyrimidin-5-yloxy-2-pyridinyl)ethanone |
| SMILES | CCc1nc(CC(=O)c2cc(Oc3cncnc3)ccn2)ccc1F |
| InChI | InChI=1S/C18H15FN4O2/c1-2-16-15(19)4-3-12(23-16)7-18(24)17-8-13(5-6-22-17)25-14-9-20-11-21-10-14/h3-6,8-11H,2,7H2,1H3 |
| InChIKey | KJLKUAOFUOTDBL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 77.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |