C17H14ClN5O — CID 58349293
2-(6-chloro-2-pyridinyl)-1-[4-[methyl(pyrimidin-5-yl)amino]-2-pyridinyl]ethanone (PubChem CID 58349293) has the molecular formula C17H14ClN5O and a molecular weight of 339.79 g/mol. Its IUPAC name is 2-(6-chloro-2-pyridinyl)-1-[4-[methyl(pyrimidin-5-yl)amino]-2-pyridinyl]ethanone.
| Compound Name | 2-(6-chloro-2-pyridinyl)-1-[4-[methyl(pyrimidin-5-yl)amino]-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 58349293 |
| Molecular Formula | C17H14ClN5O |
| Molecular Weight | 339.79 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-(6-chloro-2-pyridinyl)-1-[4-[methyl(pyrimidin-5-yl)amino]-2-pyridinyl]ethanone |
| SMILES | CN(c1cncnc1)c1ccnc(C(=O)Cc2cccc(Cl)n2)c1 |
| InChI | InChI=1S/C17H14ClN5O/c1-23(14-9-19-11-20-10-14)13-5-6-21-15(8-13)16(24)7-12-3-2-4-17(18)22-12/h2-6,8-11H,7H2,1H3 |
| InChIKey | NMIHWDGQYHZTJD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.79 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|