About 2-(phenacylamino)benzoic acid
2-(phenacylamino)benzoic acid (PubChem CID 583493) has the molecular formula C15H13NO3
and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-(phenacylamino)benzoic acid.
Molecular Properties
| Compound Name | 2-(phenacylamino)benzoic acid |
| PubChem CID | 583493 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(phenacylamino)benzoic acid |
| SMILES | O=C(CNc1ccccc1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H13NO3/c17-14(11-6-2-1-3-7-11)10-16-13-9-5-4-8-12(13)15(18)19/h1-9,16H,10H2,(H,18,19) |
| InChIKey | YGBFEWLCGGNVON-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(phenacylamino)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(phenacylamino)benzoic acid?
The IUPAC name of 2-(phenacylamino)benzoic acid (CID 583493) is 2-(phenacylamino)benzoic acid.
What is the SMILES notation for 2-(phenacylamino)benzoic acid?
The canonical SMILES for 2-(phenacylamino)benzoic acid is O=C(CNc1ccccc1C(=O)O)c1ccccc1.
What is the InChIKey of 2-(phenacylamino)benzoic acid?
The InChIKey is YGBFEWLCGGNVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c17-14(11-6-2-1-3-7-11)10-16-13-9-5-4-8-12(13)15(18)19/h1-9,16H,10H2,(H,18,19).
What are the key properties of 2-(phenacylamino)benzoic acid?
2-(phenacylamino)benzoic acid has a molecular weight of 255.27 g/mol, XLogP of 2.68, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(phenacylamino)benzoic acid is sourced from PubChem (CID 583493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).