C22H30F2O4 — CID 58349589
[(1S,3S,4R)-4-[(7aS)-1-(difluoromethylidene)-4-formyl-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-formyl-4-methylcyclohexyl] acetate (PubChem CID 58349589) has the molecular formula C22H30F2O4 and a molecular weight of 396.47 g/mol. Its IUPAC name is [(1S,3S,4R)-4-[(7aS)-1-(difluoromethylidene)-4-formyl-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-formyl-4-methylcyclohexyl] acetate.
| Compound Name | [(1S,3S,4R)-4-[(7aS)-1-(difluoromethylidene)-4-formyl-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-formyl-4-methylcyclohexyl] acetate |
|---|---|
| PubChem CID | 58349589 |
| Molecular Formula | C22H30F2O4 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | [(1S,3S,4R)-4-[(7aS)-1-(difluoromethylidene)-4-formyl-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-5-yl]-3-formyl-4-methylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@](C)(C2CC[C@]3(C)C(=C(F)F)CCC3C2C=O)[C@@H](C=O)C1 |
| InChI | InChI=1S/C22H30F2O4/c1-13(27)28-15-6-8-21(2,14(10-15)11-25)18-7-9-22(3)17(16(18)12-26)4-5-19(22)20(23)24/h11-12,14-18H,4-10H2,1-3H3/t14-,15+,16?,17?,18?,21+,22+/m1/s1 |
| InChIKey | LFVMWTQHIKXDQF-AJLDPIHNSA-N |
| XLogP | 4.72 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|