About 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one
1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one (PubChem CID 58349757) has the molecular formula C24H25F2N3O2
and a molecular weight of 425.48 g/mol. Its IUPAC name is 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one.
Molecular Properties
| Compound Name | 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one |
| PubChem CID | 58349757 |
| Molecular Formula | C24H25F2N3O2 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one |
| SMILES | O=C(Cc1cnc2ccccc2c1)CN1CCC(Nc2cc(F)c(F)cc2CO)CC1 |
| InChI | InChI=1S/C24H25F2N3O2/c25-21-11-18(15-30)24(12-22(21)26)28-19-5-7-29(8-6-19)14-20(31)10-16-9-17-3-1-2-4-23(17)27-13-16/h1-4,9,11-13,19,28,30H,5-8,10,14-15H2 |
| InChIKey | APJZYUAYGLYQMF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one?
The IUPAC name of 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one (CID 58349757) is 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one.
What is the SMILES notation for 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one?
The canonical SMILES for 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one is O=C(Cc1cnc2ccccc2c1)CN1CCC(Nc2cc(F)c(F)cc2CO)CC1.
What is the InChIKey of 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one?
The InChIKey is APJZYUAYGLYQMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25F2N3O2/c25-21-11-18(15-30)24(12-22(21)26)28-19-5-7-29(8-6-19)14-20(31)10-16-9-17-3-1-2-4-23(17)27-13-16/h1-4,9,11-13,19,28,30H,5-8,10,14-15H2.
What are the key properties of 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one?
1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one has a molecular weight of 425.48 g/mol, XLogP of 3.69, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4,5-difluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-3-quinolin-3-ylpropan-2-one is sourced from PubChem (CID 58349757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).