C9H15FO — CID 58349926
(1S,4S,5R,6R)-4-ethyl-6-fluoro-5-methylcyclohex-2-en-1-ol (PubChem CID 58349926) has the molecular formula C9H15FO and a molecular weight of 158.22 g/mol. Its IUPAC name is (1S,4S,5R,6R)-4-ethyl-6-fluoro-5-methylcyclohex-2-en-1-ol.
| Compound Name | (1S,4S,5R,6R)-4-ethyl-6-fluoro-5-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 58349926 |
| Molecular Formula | C9H15FO |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (1S,4S,5R,6R)-4-ethyl-6-fluoro-5-methylcyclohex-2-en-1-ol |
| SMILES | CC[C@H]1C=C[C@H](O)[C@H](F)[C@@H]1C |
| InChI | InChI=1S/C9H15FO/c1-3-7-4-5-8(11)9(10)6(7)2/h4-9,11H,3H2,1-2H3/t6-,7+,8+,9-/m1/s1 |
| InChIKey | PJHFYPKYSQRGMJ-RYPBNFRJSA-N |
| XLogP | 1.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|