C10H17FO2 — CID 58349936
(3R,4R,5S,6R)-5-fluoro-4-methoxy-3-(methoxymethyl)-6-methylcyclohexene (PubChem CID 58349936) has the molecular formula C10H17FO2 and a molecular weight of 188.24 g/mol. Its IUPAC name is (3R,4R,5S,6R)-5-fluoro-4-methoxy-3-(methoxymethyl)-6-methylcyclohexene.
| Compound Name | (3R,4R,5S,6R)-5-fluoro-4-methoxy-3-(methoxymethyl)-6-methylcyclohexene |
|---|---|
| PubChem CID | 58349936 |
| Molecular Formula | C10H17FO2 |
| Molecular Weight | 188.24 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (3R,4R,5S,6R)-5-fluoro-4-methoxy-3-(methoxymethyl)-6-methylcyclohexene |
| SMILES | COC[C@H]1C=C[C@@H](C)[C@H](F)[C@@H]1OC |
| InChI | InChI=1S/C10H17FO2/c1-7-4-5-8(6-12-2)10(13-3)9(7)11/h4-5,7-10H,6H2,1-3H3/t7-,8-,9+,10-/m1/s1 |
| InChIKey | FMSRTRKPHDWEHR-DOLQZWNJSA-N |
| XLogP | 1.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|