C18H34 — CID 58349948
3-tert-butyl-1,2,3,4,5,5,6,6-octamethyl-4-tritiocyclohexene (PubChem CID 58349948) has the molecular formula C18H34 and a molecular weight of 252.48 g/mol. Its IUPAC name is 3-tert-butyl-1,2,3,4,5,5,6,6-octamethyl-4-tritiocyclohexene.
| Compound Name | 3-tert-butyl-1,2,3,4,5,5,6,6-octamethyl-4-tritiocyclohexene |
|---|---|
| PubChem CID | 58349948 |
| Molecular Formula | C18H34 |
| Molecular Weight | 252.48 g/mol |
| Exact Mass | 252.27 |
| IUPAC Name | 3-tert-butyl-1,2,3,4,5,5,6,6-octamethyl-4-tritiocyclohexene |
| SMILES | [3H]C1(C)C(C)(C)C(C)(C)C(C)=C(C)C1(C)C(C)(C)C |
| InChI | InChI=1S/C18H34/c1-12-13(2)18(11,15(4,5)6)14(3)17(9,10)16(12,7)8/h14H,1-11H3/i14T |
| InChIKey | OYQLBWMQMHBYAU-UUEKIZJGSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|