C11H21FO2 — CID 58349951
(2R,3R,4R,5R,6S)-2,5-diethyl-3-fluoro-6-methoxy-4-methyloxane (PubChem CID 58349951) has the molecular formula C11H21FO2 and a molecular weight of 204.28 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2,5-diethyl-3-fluoro-6-methoxy-4-methyloxane.
| Compound Name | (2R,3R,4R,5R,6S)-2,5-diethyl-3-fluoro-6-methoxy-4-methyloxane |
|---|---|
| PubChem CID | 58349951 |
| Molecular Formula | C11H21FO2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2,5-diethyl-3-fluoro-6-methoxy-4-methyloxane |
| SMILES | CC[C@H]1[C@@H](OC)O[C@H](CC)[C@H](F)[C@@H]1C |
| InChI | InChI=1S/C11H21FO2/c1-5-8-7(3)10(12)9(6-2)14-11(8)13-4/h7-11H,5-6H2,1-4H3/t7-,8-,9-,10-,11+/m1/s1 |
| InChIKey | CZLCDSGBYRSHJP-ILAIQSSSSA-N |
| XLogP | 2.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |