C20H20N2O2 — CID 583500
1,2-bis(3,4-dihydro-2H-quinolin-1-yl)ethane-1,2-dione (PubChem CID 583500) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1,2-bis(3,4-dihydro-2H-quinolin-1-yl)ethane-1,2-dione.
| Compound Name | 1,2-bis(3,4-dihydro-2H-quinolin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 583500 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1,2-bis(3,4-dihydro-2H-quinolin-1-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCCc2ccccc21)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H20N2O2/c23-19(21-13-5-9-15-7-1-3-11-17(15)21)20(24)22-14-6-10-16-8-2-4-12-18(16)22/h1-4,7-8,11-12H,5-6,9-10,13-14H2 |
| InChIKey | QHCXWKOOQGBZQU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|