About 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile
4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile (PubChem CID 58350000) has the molecular formula C22H25NO3S
and a molecular weight of 383.51 g/mol. Its IUPAC name is 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile |
| PubChem CID | 58350000 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile |
| SMILES | CC(C)S(=O)(=O)C[C@@H]1CCOC[C@@H]1c1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H25NO3S/c1-16(2)27(24,25)15-21-11-12-26-14-22(21)20-9-7-19(8-10-20)18-5-3-17(13-23)4-6-18/h3-10,16,21-22H,11-12,14-15H2,1-2H3/t21-,22+/m0/s1 |
| InChIKey | NGCZACRUGSXGAB-FCHUYYIVSA-N |
| XLogP | 4.17 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile?
The IUPAC name of 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile (CID 58350000) is 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile.
What is the SMILES notation for 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile?
The canonical SMILES for 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile is CC(C)S(=O)(=O)C[C@@H]1CCOC[C@@H]1c1ccc(-c2ccc(C#N)cc2)cc1.
What is the InChIKey of 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile?
The InChIKey is NGCZACRUGSXGAB-FCHUYYIVSA-N. The full InChI is InChI=1S/C22H25NO3S/c1-16(2)27(24,25)15-21-11-12-26-14-22(21)20-9-7-19(8-10-20)18-5-3-17(13-23)4-6-18/h3-10,16,21-22H,11-12,14-15H2,1-2H3/t21-,22+/m0/s1.
What are the key properties of 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile?
4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile has a molecular weight of 383.51 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(3S,4R)-4-(propan-2-ylsulfonylmethyl)oxan-3-yl]phenyl]benzonitrile is sourced from PubChem (CID 58350000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).