C21H22Cl2O5S — CID 58350081
5-[[(1S,2R,3R,5R)-2-[(Z)-3-(3,5-dichlorophenyl)prop-1-enyl]-3,5-dihydroxycyclopentyl]methoxymethyl]thiophene-2-carboxylic acid (PubChem CID 58350081) has the molecular formula C21H22Cl2O5S and a molecular weight of 457.38 g/mol. Its IUPAC name is 5-[[(1S,2R,3R,5R)-2-[(Z)-3-(3,5-dichlorophenyl)prop-1-enyl]-3,5-dihydroxycyclopentyl]methoxymethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[(1S,2R,3R,5R)-2-[(Z)-3-(3,5-dichlorophenyl)prop-1-enyl]-3,5-dihydroxycyclopentyl]methoxymethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 58350081 |
| Molecular Formula | C21H22Cl2O5S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 5-[[(1S,2R,3R,5R)-2-[(Z)-3-(3,5-dichlorophenyl)prop-1-enyl]-3,5-dihydroxycyclopentyl]methoxymethyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(COC[C@@H]2[C@@H](/C=C\Cc3cc(Cl)cc(Cl)c3)[C@H](O)C[C@H]2O)s1 |
| InChI | InChI=1S/C21H22Cl2O5S/c22-13-6-12(7-14(23)8-13)2-1-3-16-17(19(25)9-18(16)24)11-28-10-15-4-5-20(29-15)21(26)27/h1,3-8,16-19,24-25H,2,9-11H2,(H,26,27)/b3-1-/t16-,17-,18-,19-/m1/s1 |
| InChIKey | IGNYMEGSYPUIEH-SDPYNCHPSA-N |
| XLogP | 4.43 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|