About methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate
methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate (PubChem CID 58350204) has the molecular formula C11H19F2NO2
and a molecular weight of 235.27 g/mol. Its IUPAC name is methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate.
Molecular Properties
| Compound Name | methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate |
| PubChem CID | 58350204 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate |
| SMILES | COC(=O)[C@@H](N)CC(F)(F)C1CCCCC1 |
| InChI | InChI=1S/C11H19F2NO2/c1-16-10(15)9(14)7-11(12,13)8-5-3-2-4-6-8/h8-9H,2-7,14H2,1H3/t9-/m0/s1 |
| InChIKey | HBPPDMVFYVQKOI-VIFPVBQESA-N |
| XLogP | 2.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate?
The IUPAC name of methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate (CID 58350204) is methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate.
What is the SMILES notation for methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate?
The canonical SMILES for methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate is COC(=O)[C@@H](N)CC(F)(F)C1CCCCC1.
What is the InChIKey of methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate?
The InChIKey is HBPPDMVFYVQKOI-VIFPVBQESA-N. The full InChI is InChI=1S/C11H19F2NO2/c1-16-10(15)9(14)7-11(12,13)8-5-3-2-4-6-8/h8-9H,2-7,14H2,1H3/t9-/m0/s1.
What are the key properties of methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate?
methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate has a molecular weight of 235.27 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-amino-4-cyclohexyl-4,4-difluorobutanoate is sourced from PubChem (CID 58350204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).