C23H26N2O2 — CID 58350252
3-prop-2-enyl-6-[(3-prop-2-enyl-2,4-dihydro-1,3-benzoxazin-6-yl)methyl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 58350252) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 3-prop-2-enyl-6-[(3-prop-2-enyl-2,4-dihydro-1,3-benzoxazin-6-yl)methyl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-prop-2-enyl-6-[(3-prop-2-enyl-2,4-dihydro-1,3-benzoxazin-6-yl)methyl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 58350252 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 3-prop-2-enyl-6-[(3-prop-2-enyl-2,4-dihydro-1,3-benzoxazin-6-yl)methyl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | C=CCN1COc2ccc(Cc3ccc4c(c3)CN(CC=C)CO4)cc2C1 |
| InChI | InChI=1S/C23H26N2O2/c1-3-9-24-14-20-12-18(5-7-22(20)26-16-24)11-19-6-8-23-21(13-19)15-25(10-4-2)17-27-23/h3-8,12-13H,1-2,9-11,14-17H2 |
| InChIKey | BMZBYGDVQRVCGW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|