C12H15NO3 — CID 58350446
4,6-bis(ethenyl)-2-(hydroxymethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 58350446) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 4,6-bis(ethenyl)-2-(hydroxymethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 4,6-bis(ethenyl)-2-(hydroxymethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 58350446 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 4,6-bis(ethenyl)-2-(hydroxymethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | C=CC1CC(C=C)C2C(=O)N(CO)C(=O)C12 |
| InChI | InChI=1S/C12H15NO3/c1-3-7-5-8(4-2)10-9(7)11(15)13(6-14)12(10)16/h3-4,7-10,14H,1-2,5-6H2 |
| InChIKey | SIWRNTAYXQADJE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|