C19H25N5O8 — CID 58350608
methyl N-[1-[1-[2-(2,5-dioxopyrrol-1-yl)prop-2-enoylamino]ethenylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 58350608) has the molecular formula C19H25N5O8 and a molecular weight of 451.44 g/mol. Its IUPAC name is methyl N-[1-[1-[2-(2,5-dioxopyrrol-1-yl)prop-2-enoylamino]ethenylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | methyl N-[1-[1-[2-(2,5-dioxopyrrol-1-yl)prop-2-enoylamino]ethenylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 58350608 |
| Molecular Formula | C19H25N5O8 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | methyl N-[1-[1-[2-(2,5-dioxopyrrol-1-yl)prop-2-enoylamino]ethenylamino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | C=C(NC(=O)C(=C)N1C(=O)C=CC1=O)NC(=O)C(CCCCNC(=O)OC)NC(=O)OC |
| InChI | InChI=1S/C19H25N5O8/c1-11(24-14(25)8-9-15(24)26)16(27)21-12(2)22-17(28)13(23-19(30)32-4)7-5-6-10-20-18(29)31-3/h8-9,13H,1-2,5-7,10H2,3-4H3,(H,20,29)(H,21,27)(H,22,28)(H,23,30) |
| InChIKey | IRPSLQJILFYVQE-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 172.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|