C47H75N4O3S+ — CID 58350920
N,N-didecyl-1-(6-ethyl-7,7,17,19,19,20-hexamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)methanesulfonamide (PubChem CID 58350920) has the molecular formula C47H75N4O3S+ and a molecular weight of 776.21 g/mol. Its IUPAC name is N,N-didecyl-1-(6-ethyl-7,7,17,19,19,20-hexamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)methanesulfonamide.
| Compound Name | N,N-didecyl-1-(6-ethyl-7,7,17,19,19,20-hexamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)methanesulfonamide |
|---|---|
| PubChem CID | 58350920 |
| Molecular Formula | C47H75N4O3S+ |
| Molecular Weight | 776.21 g/mol |
| Exact Mass | 775.56 |
| IUPAC Name | N,N-didecyl-1-(6-ethyl-7,7,17,19,19,20-hexamethyl-2-oxa-13,20-diaza-6-azoniapentacyclo[12.8.0.03,12.05,10.016,21]docosa-1(14),3,5,8,10,12,15,21-octaen-9-yl)methanesulfonamide |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)S(=O)(=O)CC1=CC(C)(C)[N+](CC)=c2cc3c(cc21)=Nc1cc2c(cc1O3)N(C)C(C)(C)CC2C |
| InChI | InChI=1S/C47H75N4O3S/c1-10-13-15-17-19-21-23-25-27-50(28-26-24-22-20-18-16-14-11-2)55(52,53)35-37-34-47(7,8)51(12-3)43-32-45-41(30-39(37)43)48-40-29-38-36(4)33-46(5,6)49(9)42(38)31-44(40)54-45/h29-32,34,36H,10-28,33,35H2,1-9H3/q+1 |
| InChIKey | UITPSENECZFDDG-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.21 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|