C24H18N15P3 — CID 58351034
2,2,4,4,6,6-hexa(pyrimidin-5-yl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene (PubChem CID 58351034) has the molecular formula C24H18N15P3 and a molecular weight of 609.44 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexa(pyrimidin-5-yl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | 2,2,4,4,6,6-hexa(pyrimidin-5-yl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 58351034 |
| Molecular Formula | C24H18N15P3 |
| Molecular Weight | 609.44 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | 2,2,4,4,6,6-hexa(pyrimidin-5-yl)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
| SMILES | c1ncc(P2(c3cncnc3)=NP(c3cncnc3)(c3cncnc3)=NP(c3cncnc3)(c3cncnc3)=N2)cn1 |
| InChI | InChI=1S/C24H18N15P3/c1-19(2-26-13-25-1)40(20-3-27-14-28-4-20)37-41(21-5-29-15-30-6-21,22-7-31-16-32-8-22)39-42(38-40,23-9-33-17-34-10-23)24-11-35-18-36-12-24/h1-18H |
| InChIKey | LBACEJSKNMJCON-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 191.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.44 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|