C21H39IO3Si — CID 58351180
[(E,1S)-1-[(2R,3S,4R,4aR,6S,8aS)-6-ethyl-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-iodoprop-2-enoxy]-tert-butyl-dimethylsilane (PubChem CID 58351180) has the molecular formula C21H39IO3Si and a molecular weight of 494.53 g/mol. Its IUPAC name is [(E,1S)-1-[(2R,3S,4R,4aR,6S,8aS)-6-ethyl-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-iodoprop-2-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E,1S)-1-[(2R,3S,4R,4aR,6S,8aS)-6-ethyl-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-iodoprop-2-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 58351180 |
| Molecular Formula | C21H39IO3Si |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | [(E,1S)-1-[(2R,3S,4R,4aR,6S,8aS)-6-ethyl-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]-3-iodoprop-2-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC[C@H]1CC[C@@H]2O[C@@H]([C@H](/C=C/I)O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](C)[C@H]2O1 |
| InChI | InChI=1S/C21H39IO3Si/c1-9-16-10-11-17-19(23-16)14(2)15(3)20(24-17)18(12-13-22)25-26(7,8)21(4,5)6/h12-20H,9-11H2,1-8H3/b13-12+/t14-,15+,16+,17+,18+,19-,20-/m1/s1 |
| InChIKey | IQEPBZOELXLCPK-WJVQGLONSA-N |
| XLogP | 6.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|