C21H39IO4Si — CID 58351201
tert-butyl-[(E)-3-iodo-1-[6-(methoxymethyl)-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]prop-2-enoxy]-dimethylsilane (PubChem CID 58351201) has the molecular formula C21H39IO4Si and a molecular weight of 510.53 g/mol. Its IUPAC name is tert-butyl-[(E)-3-iodo-1-[6-(methoxymethyl)-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]prop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-3-iodo-1-[6-(methoxymethyl)-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]prop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 58351201 |
| Molecular Formula | C21H39IO4Si |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | tert-butyl-[(E)-3-iodo-1-[6-(methoxymethyl)-3,4-dimethyl-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-2-yl]prop-2-enoxy]-dimethylsilane |
| SMILES | COCC1CCC2OC(C(/C=C/I)O[Si](C)(C)C(C)(C)C)C(C)C(C)C2O1 |
| InChI | InChI=1S/C21H39IO4Si/c1-14-15(2)20(18(11-12-22)26-27(7,8)21(3,4)5)25-17-10-9-16(13-23-6)24-19(14)17/h11-12,14-20H,9-10,13H2,1-8H3/b12-11+ |
| InChIKey | GZBSYAXGGHGXNM-VAWYXSNFSA-N |
| XLogP | 5.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|