About 2-hexyl-1,3-thiazolidine-4-carboxylic acid
2-hexyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 583513) has the molecular formula C10H19NO2S
and a molecular weight of 217.33 g/mol. Its IUPAC name is 2-hexyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-hexyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 583513 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-hexyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CCCCCCC1NC(C(=O)O)CS1 |
| InChI | InChI=1S/C10H19NO2S/c1-2-3-4-5-6-9-11-8(7-14-9)10(12)13/h8-9,11H,2-7H2,1H3,(H,12,13) |
| InChIKey | HKDGCSSFNOHHPI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 2-hexyl-1,3-thiazolidine-4-carboxylic acid (CID 583513) is 2-hexyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 2-hexyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 2-hexyl-1,3-thiazolidine-4-carboxylic acid is CCCCCCC1NC(C(=O)O)CS1.
What is the InChIKey of 2-hexyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is HKDGCSSFNOHHPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2S/c1-2-3-4-5-6-9-11-8(7-14-9)10(12)13/h8-9,11H,2-7H2,1H3,(H,12,13).
What are the key properties of 2-hexyl-1,3-thiazolidine-4-carboxylic acid?
2-hexyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 217.33 g/mol, XLogP of 2.07, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 583513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).