About 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid
2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid (PubChem CID 58351310) has the molecular formula C16H32O7Si
and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid.
Molecular Properties
| Compound Name | 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid |
| PubChem CID | 58351310 |
| Molecular Formula | C16H32O7Si |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid |
| SMILES | CCC(C)(CC(C)(C)C(=O)OCCC[Si](OC)(OC)OC)C(=O)O |
| InChI | InChI=1S/C16H32O7Si/c1-8-16(4,13(17)18)12-15(2,3)14(19)23-10-9-11-24(20-5,21-6)22-7/h8-12H2,1-7H3,(H,17,18) |
| InChIKey | MLWWRTRNZOPQLM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid?
The IUPAC name of 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid (CID 58351310) is 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid.
What is the SMILES notation for 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid?
The canonical SMILES for 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid is CCC(C)(CC(C)(C)C(=O)OCCC[Si](OC)(OC)OC)C(=O)O.
What is the InChIKey of 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid?
The InChIKey is MLWWRTRNZOPQLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O7Si/c1-8-16(4,13(17)18)12-15(2,3)14(19)23-10-9-11-24(20-5,21-6)22-7/h8-12H2,1-7H3,(H,17,18).
What are the key properties of 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid?
2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid has a molecular weight of 364.51 g/mol, XLogP of 2.71, 12 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,4,4-trimethyl-5-oxo-5-(3-trimethoxysilylpropoxy)pentanoic acid is sourced from PubChem (CID 58351310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).