About CID 58351583
CID 58351583 (PubChem CID 58351583) has the molecular formula C47H50N5O4Re-
and a molecular weight of 935.15 g/mol.
Molecular Properties
| Compound Name | CID 58351583 |
| PubChem CID | 58351583 |
| Molecular Formula | C47H50N5O4Re- |
| Molecular Weight | 935.15 g/mol |
| Exact Mass | 935.34 |
| IUPAC Name | — |
| SMILES | CCCCCCCC1Oc2ccc(nc2)-c2cccc(n2)-c2ccc(cn2)OCCCCCCCCOc2cccnc2-c2[c-]c(-c3ccccn3)c(cc2)O1.[Re] |
| InChI | InChI=1S/C47H50N5O4.Re/c1-2-3-4-7-10-21-46-55-37-24-26-41(51-34-37)43-19-15-18-42(52-43)40-25-23-36(33-50-40)53-30-13-8-5-6-9-14-31-54-45-20-16-29-49-47(45)35-22-27-44(56-46)38(32-35)39-17-11-12-28-48-39;/h11-12,15-20,22-29,33-34,46H,2-10,13-14,21,30-31H2,1H3;/q-1; |
| InChIKey | JGRPSSFFIMAOHC-UHFFFAOYSA-N |
| XLogP | 11.38 |
| TPSA | 101.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 935.15 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58351583 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58351583?
The IUPAC name of CID 58351583 (CID 58351583) is not available.
What is the SMILES notation for CID 58351583?
The canonical SMILES for CID 58351583 is CCCCCCCC1Oc2ccc(nc2)-c2cccc(n2)-c2ccc(cn2)OCCCCCCCCOc2cccnc2-c2[c-]c(-c3ccccn3)c(cc2)O1.[Re].
What is the InChIKey of CID 58351583?
The InChIKey is JGRPSSFFIMAOHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C47H50N5O4.Re/c1-2-3-4-7-10-21-46-55-37-24-26-41(51-34-37)43-19-15-18-42(52-43)40-25-23-36(33-50-40)53-30-13-8-5-6-9-14-31-54-45-20-16-29-49-47(45)35-22-27-44(56-46)38(32-35)39-17-11-12-28-48-39;/h11-12,15-20,22-29,33-34,46H,2-10,13-14,21,30-31H2,1H3;/q-1;.
What are the key properties of CID 58351583?
CID 58351583 has a molecular weight of 935.15 g/mol, XLogP of 11.38, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58351583 is sourced from PubChem (CID 58351583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).