C20H32O8 — CID 58351979
[6-oxo-6-(2-prop-2-enoyloxyethoxy)hexyl] 6-propanoyloxyhexanoate (PubChem CID 58351979) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is [6-oxo-6-(2-prop-2-enoyloxyethoxy)hexyl] 6-propanoyloxyhexanoate.
| Compound Name | [6-oxo-6-(2-prop-2-enoyloxyethoxy)hexyl] 6-propanoyloxyhexanoate |
|---|---|
| PubChem CID | 58351979 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [6-oxo-6-(2-prop-2-enoyloxyethoxy)hexyl] 6-propanoyloxyhexanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCCCCOC(=O)CCCCCOC(=O)CC |
| InChI | InChI=1S/C20H32O8/c1-3-17(21)25-13-9-5-7-11-19(23)26-14-10-6-8-12-20(24)28-16-15-27-18(22)4-2/h4H,2-3,5-16H2,1H3 |
| InChIKey | UJUKYXFIGVVZDN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|