C8H5IN4S2 — CID 58352138
6-(6-iodo-3-pyridinyl)-1H-1,3,5-triazine-2,4-dithione (PubChem CID 58352138) has the molecular formula C8H5IN4S2 and a molecular weight of 348.19 g/mol. Its IUPAC name is 6-(6-iodo-3-pyridinyl)-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-(6-iodo-3-pyridinyl)-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 58352138 |
| Molecular Formula | C8H5IN4S2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.90 |
| IUPAC Name | 6-(6-iodo-3-pyridinyl)-1H-1,3,5-triazine-2,4-dithione |
| SMILES | S=c1nc(-c2ccc(I)nc2)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C8H5IN4S2/c9-5-2-1-4(3-10-5)6-11-7(14)13-8(15)12-6/h1-3H,(H2,11,12,13,14,15) |
| InChIKey | CVCDIEGFFCJHCM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|