C14H10BrN5S2 — CID 58352165
6-[4-(5-bromopyrimidin-2-yl)-3-methylphenyl]-1H-1,3,5-triazine-2,4-dithione (PubChem CID 58352165) has the molecular formula C14H10BrN5S2 and a molecular weight of 392.31 g/mol. Its IUPAC name is 6-[4-(5-bromopyrimidin-2-yl)-3-methylphenyl]-1H-1,3,5-triazine-2,4-dithione.
| Compound Name | 6-[4-(5-bromopyrimidin-2-yl)-3-methylphenyl]-1H-1,3,5-triazine-2,4-dithione |
|---|---|
| PubChem CID | 58352165 |
| Molecular Formula | C14H10BrN5S2 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | 6-[4-(5-bromopyrimidin-2-yl)-3-methylphenyl]-1H-1,3,5-triazine-2,4-dithione |
| SMILES | Cc1cc(-c2nc(=S)[nH]c(=S)[nH]2)ccc1-c1ncc(Br)cn1 |
| InChI | InChI=1S/C14H10BrN5S2/c1-7-4-8(11-18-13(21)20-14(22)19-11)2-3-10(7)12-16-5-9(15)6-17-12/h2-6H,1H3,(H2,18,19,20,21,22) |
| InChIKey | VTZHYGFKCGIQEP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|