C10H12F4O7S — CID 58352277
2-[2,2-difluoro-3-(2-methylprop-2-enoyloxy)butanoyl]oxy-1,1-difluoroethanesulfonic acid (PubChem CID 58352277) has the molecular formula C10H12F4O7S and a molecular weight of 352.26 g/mol. Its IUPAC name is 2-[2,2-difluoro-3-(2-methylprop-2-enoyloxy)butanoyl]oxy-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[2,2-difluoro-3-(2-methylprop-2-enoyloxy)butanoyl]oxy-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 58352277 |
| Molecular Formula | C10H12F4O7S |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 2-[2,2-difluoro-3-(2-methylprop-2-enoyloxy)butanoyl]oxy-1,1-difluoroethanesulfonic acid |
| SMILES | C=C(C)C(=O)OC(C)C(F)(F)C(=O)OCC(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C10H12F4O7S/c1-5(2)7(15)21-6(3)10(13,14)8(16)20-4-9(11,12)22(17,18)19/h6H,1,4H2,2-3H3,(H,17,18,19) |
| InChIKey | SSELIIDBNIDFHN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|